C11H9Cl2N3O2S — CID 104527348
2-amino-2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527348) has the molecular formula C11H9Cl2N3O2S and a molecular weight of 318.19 g/mol. Its IUPAC name is 2-amino-2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 104527348 |
| Molecular Formula | C11H9Cl2N3O2S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 2-amino-2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | NC(C(=O)O)c1csc(Nc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl2N3O2S/c12-5-1-2-6(13)7(3-5)15-11-16-8(4-19-11)9(14)10(17)18/h1-4,9H,14H2,(H,15,16)(H,17,18) |
| InChIKey | ZLCOOHDUEHUZQK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |