2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid

C11H9Br2N3O2S — CID 107604300

IUPAC2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid
SMILESNC(C(=O)O)c1csc(Nc2c(Br)cccc2Br)n1
InChIInChI=1S/C11H9Br2N3O2S/c12-5-2-1-3-6(13)9(5)16-11-15-7(4-19-11)8(14)10(17)18/h1-4,8H,14H2,(H,15,16)(H,17,18)
InChIKeyDWGVJSJVYNBKPG-UHFFFAOYSA-N
MW407.09 g/mol
LogP3.50
Rot. Bonds4

About 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid

2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 107604300) has the molecular formula C11H9Br2N3O2S and a molecular weight of 407.09 g/mol. Its IUPAC name is 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid
PubChem CID107604300
Molecular FormulaC11H9Br2N3O2S
Molecular Weight407.09 g/mol
Exact Mass404.88
IUPAC Name2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid
SMILESNC(C(=O)O)c1csc(Nc2c(Br)cccc2Br)n1
InChIInChI=1S/C11H9Br2N3O2S/c12-5-2-1-3-6(13)9(5)16-11-15-7(4-19-11)8(14)10(17)18/h1-4,8H,14H2,(H,15,16)(H,17,18)
InChIKeyDWGVJSJVYNBKPG-UHFFFAOYSA-N
XLogP3.50
TPSA88.24 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500407.09
LogP ≤ 53.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid (CID 107604300) is 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid is NC(C(=O)O)c1csc(Nc2c(Br)cccc2Br)n1.
What is the InChIKey of 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is DWGVJSJVYNBKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Br2N3O2S/c12-5-2-1-3-6(13)9(5)16-11-15-7(4-19-11)8(14)10(17)18/h1-4,8H,14H2,(H,15,16)(H,17,18).
What are the key properties of 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid?
2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 407.09 g/mol, XLogP of 3.50, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-(2,6-dibromoanilino)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 107604300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).