C11H9ClIN3O2S — CID 107638526
2-amino-2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 107638526) has the molecular formula C11H9ClIN3O2S and a molecular weight of 409.64 g/mol. Its IUPAC name is 2-amino-2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107638526 |
| Molecular Formula | C11H9ClIN3O2S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | 2-amino-2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | NC(C(=O)O)c1csc(Nc2ccc(Cl)cc2I)n1 |
| InChI | InChI=1S/C11H9ClIN3O2S/c12-5-1-2-7(6(13)3-5)15-11-16-8(4-19-11)9(14)10(17)18/h1-4,9H,14H2,(H,15,16)(H,17,18) |
| InChIKey | VHHAESPVSDMJMO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|