C13H12ClIN2O2S — CID 107638521
2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]-2-methylpropanoic acid (PubChem CID 107638521) has the molecular formula C13H12ClIN2O2S and a molecular weight of 422.68 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]-2-methylpropanoic acid.
| Compound Name | 2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 107638521 |
| Molecular Formula | C13H12ClIN2O2S |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | 2-[2-(4-chloro-2-iodoanilino)-1,3-thiazol-4-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1csc(Nc2ccc(Cl)cc2I)n1 |
| InChI | InChI=1S/C13H12ClIN2O2S/c1-13(2,11(18)19)10-6-20-12(17-10)16-9-4-3-7(14)5-8(9)15/h3-6H,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | OKDNFWYDRCKXSO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|