2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid

C11H10ClN3O2S — CID 113422990

IUPAC2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid
SMILESNC(C(=O)O)c1csc(Nc2cccc(Cl)c2)n1
InChIInChI=1S/C11H10ClN3O2S/c12-6-2-1-3-7(4-6)14-11-15-8(5-18-11)9(13)10(16)17/h1-5,9H,13H2,(H,14,15)(H,16,17)
InChIKeyDYYRCHVNXYYYDQ-UHFFFAOYSA-N
MW283.74 g/mol
LogP2.62
Rot. Bonds4

About 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid

2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 113422990) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid
PubChem CID113422990
Molecular FormulaC11H10ClN3O2S
Molecular Weight283.74 g/mol
Exact Mass283.02
IUPAC Name2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid
SMILESNC(C(=O)O)c1csc(Nc2cccc(Cl)c2)n1
InChIInChI=1S/C11H10ClN3O2S/c12-6-2-1-3-7(4-6)14-11-15-8(5-18-11)9(13)10(16)17/h1-5,9H,13H2,(H,14,15)(H,16,17)
InChIKeyDYYRCHVNXYYYDQ-UHFFFAOYSA-N
XLogP2.62
TPSA88.24 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.74
LogP ≤ 52.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid (CID 113422990) is 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid is NC(C(=O)O)c1csc(Nc2cccc(Cl)c2)n1.
What is the InChIKey of 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is DYYRCHVNXYYYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O2S/c12-6-2-1-3-7(4-6)14-11-15-8(5-18-11)9(13)10(16)17/h1-5,9H,13H2,(H,14,15)(H,16,17).
What are the key properties of 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid?
2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 283.74 g/mol, XLogP of 2.62, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 113422990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).