C11H10ClN3O2S — CID 113422990
2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 113422990) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 113422990 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-amino-2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | NC(C(=O)O)c1csc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C11H10ClN3O2S/c12-6-2-1-3-7(4-6)14-11-15-8(5-18-11)9(13)10(16)17/h1-5,9H,13H2,(H,14,15)(H,16,17) |
| InChIKey | DYYRCHVNXYYYDQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |