C13H10N4O4S3 — CID 108777065
3-nitro-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide (PubChem CID 108777065) has the molecular formula C13H10N4O4S3 and a molecular weight of 382.45 g/mol. Its IUPAC name is 3-nitro-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide.
| Compound Name | 3-nitro-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 108777065 |
| Molecular Formula | C13H10N4O4S3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 3-nitro-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nc(-c3cccs3)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N4O4S3/c14-24(20,21)8-3-4-9(11(6-8)17(18)19)15-13-16-10(7-23-13)12-2-1-5-22-12/h1-7H,(H,15,16)(H2,14,20,21) |
| InChIKey | IAXDLIWHPDRUNL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|