C17H23N5O4S2 — CID 18285810
4-[[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 18285810) has the molecular formula C17H23N5O4S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-[[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18285810 |
| Molecular Formula | C17H23N5O4S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 4-[[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CN1CCN(C(CNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c2cccs2)CC1 |
| InChI | InChI=1S/C17H23N5O4S2/c1-20-6-8-21(9-7-20)16(17-3-2-10-27-17)12-19-14-5-4-13(28(18,25)26)11-15(14)22(23)24/h2-5,10-11,16,19H,6-9,12H2,1H3,(H2,18,25,26) |
| InChIKey | VHIQHAFDJPAOMP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|