C21H31Cl2N5O4S2 — CID 142695734
4-[[(2R)-4-(4-methylpiperazin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide;dihydrochloride (PubChem CID 142695734) has the molecular formula C21H31Cl2N5O4S2 and a molecular weight of 552.55 g/mol. Its IUPAC name is 4-[[(2R)-4-(4-methylpiperazin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide;dihydrochloride.
| Compound Name | 4-[[(2R)-4-(4-methylpiperazin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 142695734 |
| Molecular Formula | C21H31Cl2N5O4S2 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 4-[[(2R)-4-(4-methylpiperazin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide;dihydrochloride |
| SMILES | CN1CCN(CC[C@H](CSc2ccccc2)Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])CC1.Cl.Cl |
| InChI | InChI=1S/C21H29N5O4S2.2ClH/c1-24-11-13-25(14-12-24)10-9-17(16-31-18-5-3-2-4-6-18)23-20-8-7-19(32(22,29)30)15-21(20)26(27)28;;/h2-8,15,17,23H,9-14,16H2,1H3,(H2,22,29,30);2*1H/t17-;;/m1../s1 |
| InChIKey | JQNMUYNBPFRUSK-ZEECNFPPSA-N |
| XLogP | 3.30 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|