C25H36N4O6S2 — CID 91009999
ethyl 6-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]hexanoate (PubChem CID 91009999) has the molecular formula C25H36N4O6S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is ethyl 6-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]hexanoate.
| Compound Name | ethyl 6-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]hexanoate |
|---|---|
| PubChem CID | 91009999 |
| Molecular Formula | C25H36N4O6S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | ethyl 6-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCN(C)CCC(CSc1ccccc1)Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H36N4O6S2/c1-3-35-25(30)12-8-5-9-16-28(2)17-15-20(19-36-21-10-6-4-7-11-21)27-23-14-13-22(37(26,33)34)18-24(23)29(31)32/h4,6-7,10-11,13-14,18,20,27H,3,5,8-9,12,15-17,19H2,1-2H3,(H2,26,33,34) |
| InChIKey | HBDVBOLEWFXPPG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|