C19H26N4O4S2 — CID 91298039
4-[[(2R)-1-(diethylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 91298039) has the molecular formula C19H26N4O4S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-[[(2R)-1-(diethylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(2R)-1-(diethylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 91298039 |
| Molecular Formula | C19H26N4O4S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 4-[[(2R)-1-(diethylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)C[C@H](CSc1ccccc1)Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N4O4S2/c1-3-22(4-2)13-15(14-28-16-8-6-5-7-9-16)21-18-11-10-17(29(20,26)27)12-19(18)23(24)25/h5-12,15,21H,3-4,13-14H2,1-2H3,(H2,20,26,27)/t15-/m1/s1 |
| InChIKey | JEMHMLVBBDGZGD-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|