C18H23N3O5S2 — CID 58619460
4-[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]oxy-3-nitrobenzenesulfonamide (PubChem CID 58619460) has the molecular formula C18H23N3O5S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]oxy-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]oxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 58619460 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 4-[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]oxy-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Oc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N3O5S2/c1-20(2)11-10-14(13-27-15-6-4-3-5-7-15)26-18-9-8-16(28(19,24)25)12-17(18)21(22)23/h3-9,12,14H,10-11,13H2,1-2H3,(H2,19,24,25)/t14-/m1/s1 |
| InChIKey | GUDIMHOVTBNMCH-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|