C20H28N4O4S2 — CID 90920691
N'-[(2R)-4-(diethylamino)-1-phenylsulfanylbutan-2-yl]-3-nitrobenzenesulfonohydrazide (PubChem CID 90920691) has the molecular formula C20H28N4O4S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N'-[(2R)-4-(diethylamino)-1-phenylsulfanylbutan-2-yl]-3-nitrobenzenesulfonohydrazide.
| Compound Name | N'-[(2R)-4-(diethylamino)-1-phenylsulfanylbutan-2-yl]-3-nitrobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 90920691 |
| Molecular Formula | C20H28N4O4S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N'-[(2R)-4-(diethylamino)-1-phenylsulfanylbutan-2-yl]-3-nitrobenzenesulfonohydrazide |
| SMILES | CCN(CC)CC[C@H](CSc1ccccc1)NNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H28N4O4S2/c1-3-23(4-2)14-13-17(16-29-19-10-6-5-7-11-19)21-22-30(27,28)20-12-8-9-18(15-20)24(25)26/h5-12,15,17,21-22H,3-4,13-14,16H2,1-2H3/t17-/m1/s1 |
| InChIKey | KPSVJEYDOIMLQA-QGZVFWFLSA-N |
| XLogP | 3.27 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|