C22H30N4O6S2 — CID 68853078
5-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]pentanoic acid (PubChem CID 68853078) has the molecular formula C22H30N4O6S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 5-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]pentanoic acid.
| Compound Name | 5-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 68853078 |
| Molecular Formula | C22H30N4O6S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 5-[methyl-[3-(2-nitro-4-sulfamoylanilino)-4-phenylsulfanylbutyl]amino]pentanoic acid |
| SMILES | CN(CCCCC(=O)O)CCC(CSc1ccccc1)Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H30N4O6S2/c1-25(13-6-5-9-22(27)28)14-12-17(16-33-18-7-3-2-4-8-18)24-20-11-10-19(34(23,31)32)15-21(20)26(29)30/h2-4,7-8,10-11,15,17,24H,5-6,9,12-14,16H2,1H3,(H,27,28)(H2,23,31,32) |
| InChIKey | BHVZBHWADGPEIY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|