C29H35N5O7S2 — CID 143645803
N-[4-[[(2R)-4-[[4-(hydroxyamino)-4-oxobutyl]-methylamino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methylbenzamide (PubChem CID 143645803) has the molecular formula C29H35N5O7S2 and a molecular weight of 629.76 g/mol. Its IUPAC name is N-[4-[[(2R)-4-[[4-(hydroxyamino)-4-oxobutyl]-methylamino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methylbenzamide.
| Compound Name | N-[4-[[(2R)-4-[[4-(hydroxyamino)-4-oxobutyl]-methylamino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methylbenzamide |
|---|---|
| PubChem CID | 143645803 |
| Molecular Formula | C29H35N5O7S2 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | N-[4-[[(2R)-4-[[4-(hydroxyamino)-4-oxobutyl]-methylamino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NS(=O)(=O)c2ccc(N[C@H](CCN(C)CCCC(=O)NO)CSc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C29H35N5O7S2/c1-21-10-12-22(13-11-21)29(36)32-43(40,41)25-14-15-26(27(19-25)34(38)39)30-23(20-42-24-7-4-3-5-8-24)16-18-33(2)17-6-9-28(35)31-37/h3-5,7-8,10-15,19,23,30,37H,6,9,16-18,20H2,1-2H3,(H,31,35)(H,32,36)/t23-/m1/s1 |
| InChIKey | LFSJPRVQCHURRE-HSZRJFAPSA-N |
| XLogP | 4.20 |
| TPSA | 170.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|