C33H34FN5O6S2 — CID 22730874
N-[4-[[1-(tert-butylcarbamoylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide (PubChem CID 22730874) has the molecular formula C33H34FN5O6S2 and a molecular weight of 679.80 g/mol. Its IUPAC name is N-[4-[[1-(tert-butylcarbamoylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide.
| Compound Name | N-[4-[[1-(tert-butylcarbamoylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 22730874 |
| Molecular Formula | C33H34FN5O6S2 |
| Molecular Weight | 679.80 g/mol |
| Exact Mass | 679.19 |
| IUPAC Name | N-[4-[[1-(tert-butylcarbamoylamino)-3-phenylsulfanylpropan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
| SMILES | CC(C)(C)NC(=O)NCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(-c3ccc(F)cc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H34FN5O6S2/c1-33(2,3)37-32(41)35-20-26(21-46-27-7-5-4-6-8-27)36-29-18-17-28(19-30(29)39(42)43)47(44,45)38-31(40)24-11-9-22(10-12-24)23-13-15-25(34)16-14-23/h4-19,26,36H,20-21H2,1-3H3,(H,38,40)(H2,35,37,41) |
| InChIKey | CJZASEPFXASIEU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.80 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|