C25H34N4O6S2 — CID 171543091
N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methyloxane-4-carboxamide (PubChem CID 171543091) has the molecular formula C25H34N4O6S2 and a molecular weight of 550.70 g/mol. Its IUPAC name is N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methyloxane-4-carboxamide.
| Compound Name | N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methyloxane-4-carboxamide |
|---|---|
| PubChem CID | 171543091 |
| Molecular Formula | C25H34N4O6S2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-methyloxane-4-carboxamide |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)C2(C)CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H34N4O6S2/c1-25(12-15-35-16-13-25)24(30)27-37(33,34)21-9-10-22(23(17-21)29(31)32)26-19(11-14-28(2)3)18-36-20-7-5-4-6-8-20/h4-10,17,19,26H,11-16,18H2,1-3H3,(H,27,30)/t19-/m1/s1 |
| InChIKey | JLPHKGARHRHRHK-LJQANCHMSA-N |
| XLogP | 3.74 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|