C26H37IN4O6S2 — CID 171543000
[2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-methoxycyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium (PubChem CID 171543000) has the molecular formula C26H37IN4O6S2 and a molecular weight of 692.64 g/mol. Its IUPAC name is [2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-methoxycyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium.
| Compound Name | [2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-methoxycyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 171543000 |
| Molecular Formula | C26H37IN4O6S2 |
| Molecular Weight | 692.64 g/mol |
| Exact Mass | 692.12 |
| IUPAC Name | [2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-methoxycyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium |
| SMILES | COC1(C(=O)NS(=O)(=O)c2ccc(N[C@H](CCN(C)C)CSc3ccccc3)c([I-][N+](=O)O)c2)CCCCC1 |
| InChI | InChI=1S/C26H37IN4O6S2/c1-30(2)17-14-20(19-38-21-10-6-4-7-11-21)28-24-13-12-22(18-23(24)27-31(33)34)39(35,36)29-25(32)26(37-3)15-8-5-9-16-26/h4,6-7,10-13,18,20,28H,5,8-9,14-17,19H2,1-3H3,(H,29,32)(H,33,34)/t20-/m1/s1 |
| InChIKey | ALNWAVUNUCJAGE-HXUWFJFHSA-N |
| XLogP | 0.71 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.64 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|