C26H32F3IN4O5S2 — CID 171543241
[2-[[(2R)-4-(3,3-difluoroazetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium (PubChem CID 171543241) has the molecular formula C26H32F3IN4O5S2 and a molecular weight of 728.60 g/mol. Its IUPAC name is [2-[[(2R)-4-(3,3-difluoroazetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium.
| Compound Name | [2-[[(2R)-4-(3,3-difluoroazetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 171543241 |
| Molecular Formula | C26H32F3IN4O5S2 |
| Molecular Weight | 728.60 g/mol |
| Exact Mass | 728.08 |
| IUPAC Name | [2-[[(2R)-4-(3,3-difluoroazetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium |
| SMILES | O=C(NS(=O)(=O)c1ccc(N[C@H](CCN2CC(F)(F)C2)CSc2ccccc2)c([I-][N+](=O)O)c1)C1(F)CCCCC1 |
| InChI | InChI=1S/C26H32F3IN4O5S2/c27-25(12-5-2-6-13-25)24(35)32-41(38,39)21-9-10-23(22(15-21)30-34(36)37)31-19(11-14-33-17-26(28,29)18-33)16-40-20-7-3-1-4-8-20/h1,3-4,7-10,15,19,31H,2,5-6,11-14,16-18H2,(H,32,35)(H,36,37)/t19-/m1/s1 |
| InChIKey | VVADFGJAGWNZDG-LJQANCHMSA-N |
| XLogP | 1.42 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.60 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|