C26H34FIN4O5S2 — CID 171543385
[2-[[(2R)-4-(azetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium (PubChem CID 171543385) has the molecular formula C26H34FIN4O5S2 and a molecular weight of 692.62 g/mol. Its IUPAC name is [2-[[(2R)-4-(azetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium.
| Compound Name | [2-[[(2R)-4-(azetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 171543385 |
| Molecular Formula | C26H34FIN4O5S2 |
| Molecular Weight | 692.62 g/mol |
| Exact Mass | 692.10 |
| IUPAC Name | [2-[[(2R)-4-(azetidin-1-yl)-1-phenylsulfanylbutan-2-yl]amino]-5-[(1-fluorocyclohexanecarbonyl)sulfamoyl]phenyl]iodanuidyl-hydroxy-oxoazanium |
| SMILES | O=C(NS(=O)(=O)c1ccc(N[C@H](CCN2CCC2)CSc2ccccc2)c([I-][N+](=O)O)c1)C1(F)CCCCC1 |
| InChI | InChI=1S/C26H34FIN4O5S2/c27-26(13-5-2-6-14-26)25(33)30-39(36,37)22-10-11-24(23(18-22)28-32(34)35)29-20(12-17-31-15-7-16-31)19-38-21-8-3-1-4-9-21/h1,3-4,8-11,18,20,29H,2,5-7,12-17,19H2,(H,30,33)(H,34,35)/t20-/m1/s1 |
| InChIKey | URXWPALCKSUXHD-HXUWFJFHSA-N |
| XLogP | 1.17 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.62 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|