C20H26N4O4S2 — CID 141287900
2-nitro-4-[[(2R)-1-phenylsulfanyl-4-pyrrolidin-1-ylbutan-2-yl]amino]benzenesulfonamide (PubChem CID 141287900) has the molecular formula C20H26N4O4S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 2-nitro-4-[[(2R)-1-phenylsulfanyl-4-pyrrolidin-1-ylbutan-2-yl]amino]benzenesulfonamide.
| Compound Name | 2-nitro-4-[[(2R)-1-phenylsulfanyl-4-pyrrolidin-1-ylbutan-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 141287900 |
| Molecular Formula | C20H26N4O4S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-nitro-4-[[(2R)-1-phenylsulfanyl-4-pyrrolidin-1-ylbutan-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N[C@H](CCN2CCCC2)CSc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N4O4S2/c21-30(27,28)20-9-8-16(14-19(20)24(25)26)22-17(10-13-23-11-4-5-12-23)15-29-18-6-2-1-3-7-18/h1-3,6-9,14,17,22H,4-5,10-13,15H2,(H2,21,27,28)/t17-/m1/s1 |
| InChIKey | WBLDTZMQZQWDAC-QGZVFWFLSA-N |
| XLogP | 3.30 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|