C22H29N3O5PS+ — CID 146233360
ethoxy-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]-oxophosphanium (PubChem CID 146233360) has the molecular formula C22H29N3O5PS+ and a molecular weight of 478.53 g/mol. Its IUPAC name is ethoxy-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]-oxophosphanium.
| Compound Name | ethoxy-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]-oxophosphanium |
|---|---|
| PubChem CID | 146233360 |
| Molecular Formula | C22H29N3O5PS+ |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethoxy-[4-[[(2R)-4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]-oxophosphanium |
| SMILES | CCO[P+](=O)c1ccc(N[C@H](CCN2CCOCC2)CSc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H29N3O5PS/c1-2-30-31(28)19-8-9-21(22(16-19)25(26)27)23-18(10-11-24-12-14-29-15-13-24)17-32-20-6-4-3-5-7-20/h3-9,16,18,23H,2,10-15,17H2,1H3/q+1/t18-/m1/s1 |
| InChIKey | GTZPIOGPSHPAJC-GOSISDBHSA-N |
| XLogP | 4.29 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|