C36H42F3N4O7PS3 — CID 155100965
4-[[4-[4-(3-diphenoxyphosphorylpropyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 155100965) has the molecular formula C36H42F3N4O7PS3 and a molecular weight of 826.92 g/mol. Its IUPAC name is 4-[[4-[4-(3-diphenoxyphosphorylpropyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-[[4-[4-(3-diphenoxyphosphorylpropyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155100965 |
| Molecular Formula | C36H42F3N4O7PS3 |
| Molecular Weight | 826.92 g/mol |
| Exact Mass | 826.19 |
| IUPAC Name | 4-[[4-[4-(3-diphenoxyphosphorylpropyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC(CCN2CCN(CCCP(=O)(Oc3ccccc3)Oc3ccccc3)CC2)CSc2ccccc2)c(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C36H42F3N4O7PS3/c37-36(38,39)53(45,46)35-27-33(54(40,47)48)17-18-34(35)41-29(28-52-32-15-8-3-9-16-32)19-21-43-24-22-42(23-25-43)20-10-26-51(44,49-30-11-4-1-5-12-30)50-31-13-6-2-7-14-31/h1-9,11-18,27,29,41H,10,19-26,28H2,(H2,40,47,48) |
| InChIKey | FTBDQMAZSVOEQL-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.92 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|