C20H25F3N4O5S3 — CID 175397509
N-methyl-2-[[(3R)-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]amino]acetamide (PubChem CID 175397509) has the molecular formula C20H25F3N4O5S3 and a molecular weight of 554.64 g/mol. Its IUPAC name is N-methyl-2-[[(3R)-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]amino]acetamide.
| Compound Name | N-methyl-2-[[(3R)-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]amino]acetamide |
|---|---|
| PubChem CID | 175397509 |
| Molecular Formula | C20H25F3N4O5S3 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | N-methyl-2-[[(3R)-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]amino]acetamide |
| SMILES | CNC(=O)CNCC[C@H](CSc1ccccc1)Nc1ccc(S(N)(=O)=O)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H25F3N4O5S3/c1-25-19(28)12-26-10-9-14(13-33-15-5-3-2-4-6-15)27-17-8-7-16(35(24,31)32)11-18(17)34(29,30)20(21,22)23/h2-8,11,14,26-27H,9-10,12-13H2,1H3,(H,25,28)(H2,24,31,32)/t14-/m1/s1 |
| InChIKey | NWSBHBNIEVFROD-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|