C20H26F3N3O6S4 — CID 175397497
4-[[(2R)-4-(2-methylsulfonylethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 175397497) has the molecular formula C20H26F3N3O6S4 and a molecular weight of 589.71 g/mol. Its IUPAC name is 4-[[(2R)-4-(2-methylsulfonylethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-[[(2R)-4-(2-methylsulfonylethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 175397497 |
| Molecular Formula | C20H26F3N3O6S4 |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.07 |
| IUPAC Name | 4-[[(2R)-4-(2-methylsulfonylethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCNCC[C@H](CSc1ccccc1)Nc1ccc(S(N)(=O)=O)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H26F3N3O6S4/c1-34(27,28)12-11-25-10-9-15(14-33-16-5-3-2-4-6-16)26-18-8-7-17(36(24,31)32)13-19(18)35(29,30)20(21,22)23/h2-8,13,15,25-26H,9-12,14H2,1H3,(H2,24,31,32)/t15-/m1/s1 |
| InChIKey | LEFOZGAGERBJQV-OAHLLOKOSA-N |
| XLogP | 2.22 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|