C28H39F3N4O5S3 — CID 166823184
N-pentyl-1-[4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]piperidine-4-carboxamide (PubChem CID 166823184) has the molecular formula C28H39F3N4O5S3 and a molecular weight of 664.84 g/mol. Its IUPAC name is N-pentyl-1-[4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]piperidine-4-carboxamide.
| Compound Name | N-pentyl-1-[4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166823184 |
| Molecular Formula | C28H39F3N4O5S3 |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | N-pentyl-1-[4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butyl]piperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(CCC(CSc2ccccc2)Nc2ccc(S(N)(=O)=O)cc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H39F3N4O5S3/c1-2-3-7-15-33-27(36)21-12-16-35(17-13-21)18-14-22(20-41-23-8-5-4-6-9-23)34-25-11-10-24(43(32,39)40)19-26(25)42(37,38)28(29,30)31/h4-6,8-11,19,21-22,34H,2-3,7,12-18,20H2,1H3,(H,33,36)(H2,32,39,40) |
| InChIKey | LHTYDPOFKXVSKE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|