C53H62F3N3O7S3Si2 — CID 87125178
N,N-bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butanamide (PubChem CID 87125178) has the molecular formula C53H62F3N3O7S3Si2 and a molecular weight of 1062.46 g/mol. Its IUPAC name is N,N-bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butanamide.
| Compound Name | N,N-bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butanamide |
|---|---|
| PubChem CID | 87125178 |
| Molecular Formula | C53H62F3N3O7S3Si2 |
| Molecular Weight | 1062.46 g/mol |
| Exact Mass | 1061.32 |
| IUPAC Name | N,N-bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylsulfanyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]butanamide |
| SMILES | CC(C)(C)[Si](OCCN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)CC(CSc1ccccc1)Nc1ccc(S(N)(=O)=O)cc1S(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H62F3N3O7S3Si2/c1-51(2,3)70(44-24-14-8-15-25-44,45-26-16-9-17-27-45)65-36-34-59(35-37-66-71(52(4,5)6,46-28-18-10-19-29-46)47-30-20-11-21-31-47)50(60)38-41(40-67-42-22-12-7-13-23-42)58-48-33-32-43(69(57,63)64)39-49(48)68(61,62)53(54,55)56/h7-33,39,41,58H,34-38,40H2,1-6H3,(H2,57,63,64) |
| InChIKey | SVMTWRZHUGSGMA-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.46 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|