C16H21N3O4S3 — CID 55434495
4-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzene-1,4-disulfonamide (PubChem CID 55434495) has the molecular formula C16H21N3O4S3 and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 55434495 |
| Molecular Formula | C16H21N3O4S3 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NCC(c2cccs2)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H21N3O4S3/c17-25(20,21)13-5-7-14(8-6-13)26(22,23)18-12-15(16-4-3-11-24-16)19-9-1-2-10-19/h3-8,11,15,18H,1-2,9-10,12H2,(H2,17,20,21) |
| InChIKey | ZBOMGUDBGBRLLP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |