C17H29N3O2S2 — CID 110622492
N-[[2-(azepan-1-yl)-2-thiophen-2-ylethyl]sulfamoyl]cyclopentanamine (PubChem CID 110622492) has the molecular formula C17H29N3O2S2 and a molecular weight of 371.57 g/mol. Its IUPAC name is N-[[2-(azepan-1-yl)-2-thiophen-2-ylethyl]sulfamoyl]cyclopentanamine.
| Compound Name | N-[[2-(azepan-1-yl)-2-thiophen-2-ylethyl]sulfamoyl]cyclopentanamine |
|---|---|
| PubChem CID | 110622492 |
| Molecular Formula | C17H29N3O2S2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[[2-(azepan-1-yl)-2-thiophen-2-ylethyl]sulfamoyl]cyclopentanamine |
| SMILES | O=S(=O)(NCC(c1cccs1)N1CCCCCC1)NC1CCCC1 |
| InChI | InChI=1S/C17H29N3O2S2/c21-24(22,19-15-8-3-4-9-15)18-14-16(17-10-7-13-23-17)20-11-5-1-2-6-12-20/h7,10,13,15-16,18-19H,1-6,8-9,11-12,14H2 |
| InChIKey | DGLAYZUHTIHLTI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |