C16H19FN2O2S2 — CID 78786892
2-fluoro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 78786892) has the molecular formula C16H19FN2O2S2 and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-fluoro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 78786892 |
| Molecular Formula | C16H19FN2O2S2 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-fluoro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1cccs1)N1CCCC1)c1ccccc1F |
| InChI | InChI=1S/C16H19FN2O2S2/c17-13-6-1-2-8-16(13)23(20,21)18-12-14(15-7-5-11-22-15)19-9-3-4-10-19/h1-2,5-8,11,14,18H,3-4,9-10,12H2 |
| InChIKey | RKCKYGKWOVTBTG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |