C23H24FN3O3S2 — CID 24640460
3-[(2-fluorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 24640460) has the molecular formula C23H24FN3O3S2 and a molecular weight of 473.60 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 3-[(2-fluorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 24640460 |
| Molecular Formula | C23H24FN3O3S2 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCC(c1cccs1)N1CCCC1)c1cccc(S(=O)(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C23H24FN3O3S2/c24-19-9-1-2-10-20(19)26-32(29,30)18-8-5-7-17(15-18)23(28)25-16-21(22-11-6-14-31-22)27-12-3-4-13-27/h1-2,5-11,14-15,21,26H,3-4,12-13,16H2,(H,25,28) |
| InChIKey | YAJDQLUCXLKPQY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |