C16H19N3O4S2 — CID 78786890
4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 78786890) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 78786890 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NCC(c2cccs2)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H19N3O4S2/c20-19(21)13-5-7-14(8-6-13)25(22,23)17-12-15(16-4-3-11-24-16)18-9-1-2-10-18/h3-8,11,15,17H,1-2,9-10,12H2 |
| InChIKey | XCIYVUZMYNLTBW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|