C20H28N4O4S2 — CID 55346965
N,N-diethyl-3-nitro-4-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]benzenesulfonamide (PubChem CID 55346965) has the molecular formula C20H28N4O4S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N,N-diethyl-3-nitro-4-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-nitro-4-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 55346965 |
| Molecular Formula | C20H28N4O4S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N,N-diethyl-3-nitro-4-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCC(c2cccs2)N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H28N4O4S2/c1-3-23(4-2)30(27,28)16-9-10-17(18(14-16)24(25)26)21-15-19(20-8-7-13-29-20)22-11-5-6-12-22/h7-10,13-14,19,21H,3-6,11-12,15H2,1-2H3 |
| InChIKey | NWYUYDLBYHQZBB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|