C17H27N3O6S — CID 97099523
ethyl (3R)-4-[4-(diethylsulfamoyl)-2-nitroanilino]-3-methylbutanoate (PubChem CID 97099523) has the molecular formula C17H27N3O6S and a molecular weight of 401.49 g/mol. Its IUPAC name is ethyl (3R)-4-[4-(diethylsulfamoyl)-2-nitroanilino]-3-methylbutanoate.
| Compound Name | ethyl (3R)-4-[4-(diethylsulfamoyl)-2-nitroanilino]-3-methylbutanoate |
|---|---|
| PubChem CID | 97099523 |
| Molecular Formula | C17H27N3O6S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl (3R)-4-[4-(diethylsulfamoyl)-2-nitroanilino]-3-methylbutanoate |
| SMILES | CCOC(=O)C[C@@H](C)CNc1ccc(S(=O)(=O)N(CC)CC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H27N3O6S/c1-5-19(6-2)27(24,25)14-8-9-15(16(11-14)20(22)23)18-12-13(4)10-17(21)26-7-3/h8-9,11,13,18H,5-7,10,12H2,1-4H3/t13-/m1/s1 |
| InChIKey | RUGKQQOJPWOOCN-CYBMUJFWSA-N |
| XLogP | 2.63 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|