C17H18ClN3O3S — CID 43006523
2-chloro-4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 43006523) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 2-chloro-4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 43006523 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-chloro-4-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCC(c1cccs1)N1CCCC1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H18ClN3O3S/c18-14-10-12(21(23)24)5-6-13(14)17(22)19-11-15(16-4-3-9-25-16)20-7-1-2-8-20/h3-6,9-10,15H,1-2,7-8,11H2,(H,19,22) |
| InChIKey | QWXBCIILXNFVIM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|