C18H17ClN4O3S — CID 122264706
2-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-4-nitrobenzamide (PubChem CID 122264706) has the molecular formula C18H17ClN4O3S and a molecular weight of 404.88 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 122264706 |
| Molecular Formula | C18H17ClN4O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-4-nitrobenzamide |
| SMILES | Cc1cc(C)n(C(CNC(=O)c2ccc([N+](=O)[O-])cc2Cl)c2cccs2)n1 |
| InChI | InChI=1S/C18H17ClN4O3S/c1-11-8-12(2)22(21-11)16(17-4-3-7-27-17)10-20-18(24)14-6-5-13(23(25)26)9-15(14)19/h3-9,16H,10H2,1-2H3,(H,20,24) |
| InChIKey | YHTUJIPNNDZKAW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|