C14H18N2O3S3 — CID 45003189
N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide (PubChem CID 45003189) has the molecular formula C14H18N2O3S3 and a molecular weight of 358.51 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 45003189 |
| Molecular Formula | C14H18N2O3S3 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(c1cccs1)N1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C14H18N2O3S3/c17-22(18,14-4-2-10-21-14)15-11-12(13-3-1-9-20-13)16-5-7-19-8-6-16/h1-4,9-10,12,15H,5-8,11H2 |
| InChIKey | LTVBZWCWTCBRQP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |