C13H13N3O2S3 — CID 122265220
N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide (PubChem CID 122265220) has the molecular formula C13H13N3O2S3 and a molecular weight of 339.47 g/mol. Its IUPAC name is N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122265220 |
| Molecular Formula | C13H13N3O2S3 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(c1cccs1)n1cccn1)c1cccs1 |
| InChI | InChI=1S/C13H13N3O2S3/c17-21(18,13-5-2-9-20-13)15-10-11(12-4-1-8-19-12)16-7-3-6-14-16/h1-9,11,15H,10H2 |
| InChIKey | GLDCKHIUNKAPQZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |