C16H14F3N3O2S2 — CID 122265298
N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 122265298) has the molecular formula C16H14F3N3O2S2 and a molecular weight of 401.44 g/mol. Its IUPAC name is N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122265298 |
| Molecular Formula | C16H14F3N3O2S2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1cccs1)n1cccn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3N3O2S2/c17-16(18,19)12-4-6-13(7-5-12)26(23,24)21-11-14(15-3-1-10-25-15)22-9-2-8-20-22/h1-10,14,21H,11H2 |
| InChIKey | PXUWGMSRCCGVQH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |