C20H24N4O3S2 — CID 122265187
4-(diethylsulfamoyl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 122265187) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 122265187 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC(c2cccs2)n2cccn2)cc1 |
| InChI | InChI=1S/C20H24N4O3S2/c1-3-23(4-2)29(26,27)17-10-8-16(9-11-17)20(25)21-15-18(19-7-5-14-28-19)24-13-6-12-22-24/h5-14,18H,3-4,15H2,1-2H3,(H,21,25) |
| InChIKey | BLHZGIFJFFVIPP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |