C24H27N7O2S — CID 59429774
1-[4-[2-[4-[ethyl(2-methoxyethyl)amino]-2-methylanilino]-1,3-thiazol-4-yl]phenyl]-1,2,4-triazole-3-carboxamide (PubChem CID 59429774) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is 1-[4-[2-[4-[ethyl(2-methoxyethyl)amino]-2-methylanilino]-1,3-thiazol-4-yl]phenyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[4-[2-[4-[ethyl(2-methoxyethyl)amino]-2-methylanilino]-1,3-thiazol-4-yl]phenyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 59429774 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-[4-[2-[4-[ethyl(2-methoxyethyl)amino]-2-methylanilino]-1,3-thiazol-4-yl]phenyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCN(CCOC)c1ccc(Nc2nc(-c3ccc(-n4cnc(C(N)=O)n4)cc3)cs2)c(C)c1 |
| InChI | InChI=1S/C24H27N7O2S/c1-4-30(11-12-33-3)19-9-10-20(16(2)13-19)27-24-28-21(14-34-24)17-5-7-18(8-6-17)31-15-26-23(29-31)22(25)32/h5-10,13-15H,4,11-12H2,1-3H3,(H2,25,32)(H,27,28) |
| InChIKey | GTBSEHOKJWGSIC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|