C23H28N4O3S — CID 16955454
N-[4-(diethylamino)-2-methylphenyl]-2-(3,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide (PubChem CID 16955454) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(3,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(3,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16955454 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(3,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2csc(Nc3ccc(OC)c(OC)c3)n2)c(C)c1 |
| InChI | InChI=1S/C23H28N4O3S/c1-6-27(7-2)17-9-10-18(15(3)12-17)25-22(28)19-14-31-23(26-19)24-16-8-11-20(29-4)21(13-16)30-5/h8-14H,6-7H2,1-5H3,(H,24,26)(H,25,28) |
| InChIKey | ORZXHDSZVSVCBI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|