C19H19N3O4S — CID 16955084
2-(2,4-dimethoxyanilino)-N-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 16955084) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-(2,4-dimethoxyanilino)-N-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyanilino)-N-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16955084 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-(2,4-dimethoxyanilino)-N-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2csc(Nc3ccc(OC)cc3OC)n2)cc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-24-13-6-4-12(5-7-13)20-18(23)16-11-27-19(22-16)21-15-9-8-14(25-2)10-17(15)26-3/h4-11H,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | QICRFDMQAUYXRS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |