C18H23N3O3S — CID 16955034
N-cyclohexyl-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide (PubChem CID 16955034) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-cyclohexyl-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16955034 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-cyclohexyl-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(Nc2nc(C(=O)NC3CCCCC3)cs2)c(OC)c1 |
| InChI | InChI=1S/C18H23N3O3S/c1-23-13-8-9-14(16(10-13)24-2)20-18-21-15(11-25-18)17(22)19-12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | XIZZNIGQMGYRST-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |