C19H18N4O4S — CID 16955163
N-(2-carbamoylphenyl)-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide (PubChem CID 16955163) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16955163 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(2-carbamoylphenyl)-2-(2,4-dimethoxyanilino)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(Nc2nc(C(=O)Nc3ccccc3C(N)=O)cs2)c(OC)c1 |
| InChI | InChI=1S/C19H18N4O4S/c1-26-11-7-8-14(16(9-11)27-2)22-19-23-15(10-28-19)18(25)21-13-6-4-3-5-12(13)17(20)24/h3-10H,1-2H3,(H2,20,24)(H,21,25)(H,22,23) |
| InChIKey | ISWRLFSBYGVICT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |