C9H11NO4S2 — CID 14047640
2-[4-(2-ethoxy-2-oxoethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (PubChem CID 14047640) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[4-(2-ethoxy-2-oxoethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-(2-ethoxy-2-oxoethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 14047640 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-[4-(2-ethoxy-2-oxoethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| SMILES | CCOC(=O)Cc1csc(=S)n1CC(=O)O |
| InChI | InChI=1S/C9H11NO4S2/c1-2-14-8(13)3-6-5-16-9(15)10(6)4-7(11)12/h5H,2-4H2,1H3,(H,11,12) |
| InChIKey | MJUDIBFUFWBBJE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|