C24H30N3O2S+ — CID 7614944
N-benzyl-4-(3-methoxyphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-2-imine (PubChem CID 7614944) has the molecular formula C24H30N3O2S+ and a molecular weight of 424.59 g/mol. Its IUPAC name is N-benzyl-4-(3-methoxyphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-2-imine.
| Compound Name | N-benzyl-4-(3-methoxyphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7614944 |
| Molecular Formula | C24H30N3O2S+ |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-benzyl-4-(3-methoxyphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-2-imine |
| SMILES | COc1cccc(-c2cs/c(=N\Cc3ccccc3)n2CCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C24H29N3O2S/c1-28-22-10-5-9-21(17-22)23-19-30-24(25-18-20-7-3-2-4-8-20)27(23)12-6-11-26-13-15-29-16-14-26/h2-5,7-10,17,19H,6,11-16,18H2,1H3/p+1/b25-24- |
| InChIKey | QYQYWQUHFDFPCZ-IZHYLOQSSA-O |
| XLogP | 2.63 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|