C23H28N3O3S+ — CID 7868909
2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-morpholin-4-ium-4-ylpropyl)quinazolin-4-one (PubChem CID 7868909) has the molecular formula C23H28N3O3S+ and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-morpholin-4-ium-4-ylpropyl)quinazolin-4-one.
| Compound Name | 2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-morpholin-4-ium-4-ylpropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 7868909 |
| Molecular Formula | C23H28N3O3S+ |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-morpholin-4-ium-4-ylpropyl)quinazolin-4-one |
| SMILES | COc1cccc(CSc2nc3ccccc3c(=O)n2CCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C23H27N3O3S/c1-28-19-7-4-6-18(16-19)17-30-23-24-21-9-3-2-8-20(21)22(27)26(23)11-5-10-25-12-14-29-15-13-25/h2-4,6-9,16H,5,10-15,17H2,1H3/p+1 |
| InChIKey | XYJHSXOTFFSXAN-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 57.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |