C21H30N3O2S+ — CID 7614974
1-[2-(3,4-dimethylphenyl)imino-4-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 7614974) has the molecular formula C21H30N3O2S+ and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenyl)imino-4-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(3,4-dimethylphenyl)imino-4-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 7614974 |
| Molecular Formula | C21H30N3O2S+ |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-[2-(3,4-dimethylphenyl)imino-4-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1s/c(=N\c2ccc(C)c(C)c2)n(CCC[NH+]2CCOCC2)c1C |
| InChI | InChI=1S/C21H29N3O2S/c1-15-6-7-19(14-16(15)2)22-21-24(17(3)20(27-21)18(4)25)9-5-8-23-10-12-26-13-11-23/h6-7,14H,5,8-13H2,1-4H3/p+1/b22-21- |
| InChIKey | GKTIFDASCYEFDS-DQRAZIAOSA-O |
| XLogP | 2.22 |
| TPSA | 48.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|