C20H19ClN2OS — CID 138392977
1-[2-(4-chlorophenyl)imino-4-methyl-3-(2-phenylethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 138392977) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)imino-4-methyl-3-(2-phenylethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(4-chlorophenyl)imino-4-methyl-3-(2-phenylethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 138392977 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)imino-4-methyl-3-(2-phenylethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1s/c(=N\c2ccc(Cl)cc2)n(CCc2ccccc2)c1C |
| InChI | InChI=1S/C20H19ClN2OS/c1-14-19(15(2)24)25-20(22-18-10-8-17(21)9-11-18)23(14)13-12-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3/b22-20- |
| InChIKey | JBCGZTWVJOYMKZ-XDOYNYLZSA-N |
| XLogP | 5.19 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|