C19H18FN3O2S — CID 25266944
1-[2-[[6-(4-fluorophenyl)-3-pyridinyl]imino]-3-(2-hydroxyethyl)-4-methyl-1,3-thiazol-5-yl]ethanone (PubChem CID 25266944) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[2-[[6-(4-fluorophenyl)-3-pyridinyl]imino]-3-(2-hydroxyethyl)-4-methyl-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-[[6-(4-fluorophenyl)-3-pyridinyl]imino]-3-(2-hydroxyethyl)-4-methyl-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 25266944 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[2-[[6-(4-fluorophenyl)-3-pyridinyl]imino]-3-(2-hydroxyethyl)-4-methyl-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1s/c(=N\c2ccc(-c3ccc(F)cc3)nc2)n(CCO)c1C |
| InChI | InChI=1S/C19H18FN3O2S/c1-12-18(13(2)25)26-19(23(12)9-10-24)22-16-7-8-17(21-11-16)14-3-5-15(20)6-4-14/h3-8,11,24H,9-10H2,1-2H3/b22-19- |
| InChIKey | XWUMXFBTLSPSIJ-QOCHGBHMSA-N |
| XLogP | 3.49 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|